About 4-acetyl-3,4-dimethyloxetan-2-one;vanadium
4-acetyl-3,4-dimethyloxetan-2-one;vanadium (PubChem CID 159022945) has the molecular formula C7H10O3V
and a molecular weight of 193.10 g/mol. Its IUPAC name is 4-acetyl-3,4-dimethyloxetan-2-one;vanadium.
Molecular Properties
| Compound Name | 4-acetyl-3,4-dimethyloxetan-2-one;vanadium |
| PubChem CID | 159022945 |
| Molecular Formula | C7H10O3V |
| Molecular Weight | 193.10 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 4-acetyl-3,4-dimethyloxetan-2-one;vanadium |
| SMILES | CC(=O)C1(C)OC(=O)C1C.[V] |
| InChI | InChI=1S/C7H10O3.V/c1-4-6(9)10-7(4,3)5(2)8;/h4H,1-3H3; |
| InChIKey | JTXSAPVTXGKHPQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.10 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-3,4-dimethyloxetan-2-one;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-3,4-dimethyloxetan-2-one;vanadium?
The IUPAC name of 4-acetyl-3,4-dimethyloxetan-2-one;vanadium (CID 159022945) is 4-acetyl-3,4-dimethyloxetan-2-one;vanadium.
What is the SMILES notation for 4-acetyl-3,4-dimethyloxetan-2-one;vanadium?
The canonical SMILES for 4-acetyl-3,4-dimethyloxetan-2-one;vanadium is CC(=O)C1(C)OC(=O)C1C.[V].
What is the InChIKey of 4-acetyl-3,4-dimethyloxetan-2-one;vanadium?
The InChIKey is JTXSAPVTXGKHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.V/c1-4-6(9)10-7(4,3)5(2)8;/h4H,1-3H3;.
What are the key properties of 4-acetyl-3,4-dimethyloxetan-2-one;vanadium?
4-acetyl-3,4-dimethyloxetan-2-one;vanadium has a molecular weight of 193.10 g/mol, XLogP of 0.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-3,4-dimethyloxetan-2-one;vanadium is sourced from PubChem (CID 159022945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).