C41H43N7O4S2 — CID 159023373
3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)aniline;2-[3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]-1-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 159023373) has the molecular formula C41H43N7O4S2 and a molecular weight of 761.97 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)aniline;2-[3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]-1-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)aniline;2-[3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]-1-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 159023373 |
| Molecular Formula | C41H43N7O4S2 |
| Molecular Weight | 761.97 g/mol |
| Exact Mass | 761.28 |
| IUPAC Name | 3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)aniline;2-[3-[(dimethylamino)methyl]-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)phenyl]-1-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | CN(C)Cc1cc(N)cc(-c2nc3ccncc3s2)c1.COc1cc(C(=O)Cc2cc(CN(C)C)cc(-c3nc4ccncc4s3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27N3O4S.C15H16N4S/c1-29(2)15-17-8-16(9-19(10-17)26-28-20-6-7-27-14-24(20)34-26)11-21(30)18-12-22(31-3)25(33-5)23(13-18)32-4;1-19(2)9-10-5-11(7-12(16)6-10)15-18-13-3-4-17-8-14(13)20-15/h6-10,12-14H,11,15H2,1-5H3;3-8H,9,16H2,1-2H3 |
| InChIKey | JTZFINGZSJSACM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.97 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|