C3H2Cl3N3O4 — CID 159023609
1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione;hydrate (PubChem CID 159023609) has the molecular formula C3H2Cl3N3O4 and a molecular weight of 250.42 g/mol. Its IUPAC name is 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione;hydrate.
| Compound Name | 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione;hydrate |
|---|---|
| PubChem CID | 159023609 |
| Molecular Formula | C3H2Cl3N3O4 |
| Molecular Weight | 250.42 g/mol |
| Exact Mass | 248.91 |
| IUPAC Name | 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione;hydrate |
| SMILES | O.O=c1n(Cl)c(=O)n(Cl)c(=O)n1Cl |
| InChI | InChI=1S/C3Cl3N3O3.H2O/c4-7-1(10)8(5)3(12)9(6)2(7)11;/h;1H2 |
| InChIKey | JTZYMDLJYGQGAL-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 97.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.42 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |