About 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid
1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 159023833) has the molecular formula C15H17NO5
and a molecular weight of 291.30 g/mol. Its IUPAC name is 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 159023833 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid |
| SMILES | C=CN1CCCC1=O.Cc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H8O4.C6H9NO/c1-5-2-6(8(10)11)4-7(3-5)9(12)13;1-2-7-5-3-4-6(7)8/h2-4H,1H3,(H,10,11)(H,12,13);2H,1,3-5H2 |
| InChIKey | JUAUERBPWIGYKV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid (CID 159023833) is 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid is C=CN1CCCC1=O.Cc1cc(C(=O)O)cc(C(=O)O)c1.
What is the InChIKey of 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is JUAUERBPWIGYKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.C6H9NO/c1-5-2-6(8(10)11)4-7(3-5)9(12)13;1-2-7-5-3-4-6(7)8/h2-4H,1H3,(H,10,11)(H,12,13);2H,1,3-5H2.
What are the key properties of 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid?
1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 291.30 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpyrrolidin-2-one;5-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 159023833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).