C27H27N3O4S — CID 159025925
3-[5-[(3S,4S)-6-imino-1,4-dimethyl-2-oxo-3-(3,4,5-trimethoxyphenyl)piperidin-4-yl]thiophen-3-yl]benzonitrile (PubChem CID 159025925) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is 3-[5-[(3S,4S)-6-imino-1,4-dimethyl-2-oxo-3-(3,4,5-trimethoxyphenyl)piperidin-4-yl]thiophen-3-yl]benzonitrile.
| Compound Name | 3-[5-[(3S,4S)-6-imino-1,4-dimethyl-2-oxo-3-(3,4,5-trimethoxyphenyl)piperidin-4-yl]thiophen-3-yl]benzonitrile |
|---|---|
| PubChem CID | 159025925 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-[5-[(3S,4S)-6-imino-1,4-dimethyl-2-oxo-3-(3,4,5-trimethoxyphenyl)piperidin-4-yl]thiophen-3-yl]benzonitrile |
| SMILES | [H]/N=C1/C[C@](C)(c2cc(-c3cccc(C#N)c3)cs2)[C@H](c2cc(OC)c(OC)c(OC)c2)C(=O)N1C |
| InChI | InChI=1S/C27H27N3O4S/c1-27(22-12-19(15-35-22)17-8-6-7-16(9-17)14-28)13-23(29)30(2)26(31)24(27)18-10-20(32-3)25(34-5)21(11-18)33-4/h6-12,15,24,29H,13H2,1-5H3/b29-23-/t24-,27-/m1/s1 |
| InChIKey | JUGYFCLBSFIUHD-XMCPQRCNSA-N |
| XLogP | 5.19 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|