C17H19ClFN3O — CID 159027585
2-[4-[(3-fluoro-4-methoxyphenyl)methyl]phenyl]-4,5-dihydroimidazol-1-amine;hydrochloride (PubChem CID 159027585) has the molecular formula C17H19ClFN3O and a molecular weight of 335.81 g/mol. Its IUPAC name is 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]phenyl]-4,5-dihydroimidazol-1-amine;hydrochloride.
| Compound Name | 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]phenyl]-4,5-dihydroimidazol-1-amine;hydrochloride |
|---|---|
| PubChem CID | 159027585 |
| Molecular Formula | C17H19ClFN3O |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]phenyl]-4,5-dihydroimidazol-1-amine;hydrochloride |
| SMILES | COc1ccc(Cc2ccc(C3=NCCN3N)cc2)cc1F.Cl |
| InChI | InChI=1S/C17H18FN3O.ClH/c1-22-16-7-4-13(11-15(16)18)10-12-2-5-14(6-3-12)17-20-8-9-21(17)19;/h2-7,11H,8-10,19H2,1H3;1H |
| InChIKey | JULXESDLRCMDML-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|