About 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole
5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole (PubChem CID 159027737) has the molecular formula C28H36N8
and a molecular weight of 484.65 g/mol. Its IUPAC name is 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole.
Molecular Properties
| Compound Name | 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole |
| PubChem CID | 159027737 |
| Molecular Formula | C28H36N8 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole |
| SMILES | c1cc2[nH]ncc2cc1N1CCNCC12CCC2.c1cc2[nH]ncc2cc1N1CCNCC12CCC2 |
| InChI | InChI=1S/2C14H18N4/c2*1-4-14(5-1)10-15-6-7-18(14)12-2-3-13-11(8-12)9-16-17-13/h2*2-3,8-9,15H,1,4-7,10H2,(H,16,17) |
| InChIKey | JUMHUEUFZCOMIA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole?
The IUPAC name of 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole (CID 159027737) is 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole.
What is the SMILES notation for 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole?
The canonical SMILES for 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole is c1cc2[nH]ncc2cc1N1CCNCC12CCC2.c1cc2[nH]ncc2cc1N1CCNCC12CCC2.
What is the InChIKey of 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole?
The InChIKey is JUMHUEUFZCOMIA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H18N4/c2*1-4-14(5-1)10-15-6-7-18(14)12-2-3-13-11(8-12)9-16-17-13/h2*2-3,8-9,15H,1,4-7,10H2,(H,16,17).
What are the key properties of 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole?
5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole has a molecular weight of 484.65 g/mol, XLogP of 3.79, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,8-diazaspiro[3.5]nonan-5-yl)-1H-indazole is sourced from PubChem (CID 159027737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).