C38H41ClN6O2 — CID 159027999
2-chloro-6-methylnaphthalene;6-methyl-1H-2,3-benzoxazin-4-amine;7-methyl-1H-2,3-benzoxazin-4-amine;7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 159027999) has the molecular formula C38H41ClN6O2 and a molecular weight of 649.24 g/mol. Its IUPAC name is 2-chloro-6-methylnaphthalene;6-methyl-1H-2,3-benzoxazin-4-amine;7-methyl-1H-2,3-benzoxazin-4-amine;7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 2-chloro-6-methylnaphthalene;6-methyl-1H-2,3-benzoxazin-4-amine;7-methyl-1H-2,3-benzoxazin-4-amine;7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 159027999 |
| Molecular Formula | C38H41ClN6O2 |
| Molecular Weight | 649.24 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | 2-chloro-6-methylnaphthalene;6-methyl-1H-2,3-benzoxazin-4-amine;7-methyl-1H-2,3-benzoxazin-4-amine;7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | Cc1ccc2c(c1)C(N)=NOC2.Cc1ccc2c(c1)CON=C2N.Cc1ccc2c(n1)NCCC2.Cc1ccc2cc(Cl)ccc2c1 |
| InChI | InChI=1S/C11H9Cl.2C9H10N2O.C9H12N2/c1-8-2-3-10-7-11(12)5-4-9(10)6-8;1-6-2-3-8-7(4-6)5-12-11-9(8)10;1-6-2-3-7-5-12-11-9(10)8(7)4-6;1-7-4-5-8-3-2-6-10-9(8)11-7/h2-7H,1H3;2*2-4H,5H2,1H3,(H2,10,11);4-5H,2-3,6H2,1H3,(H,10,11) |
| InChIKey | JUNDGCDUPTXEGA-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.24 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |