C16H20N6O3 — CID 159028155
5-methoxy-3-[(2-methylimidazol-1-yl)methyl]pyridazine;(5-methoxypyridazin-3-yl)methanol (PubChem CID 159028155) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 5-methoxy-3-[(2-methylimidazol-1-yl)methyl]pyridazine;(5-methoxypyridazin-3-yl)methanol.
| Compound Name | 5-methoxy-3-[(2-methylimidazol-1-yl)methyl]pyridazine;(5-methoxypyridazin-3-yl)methanol |
|---|---|
| PubChem CID | 159028155 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 5-methoxy-3-[(2-methylimidazol-1-yl)methyl]pyridazine;(5-methoxypyridazin-3-yl)methanol |
| SMILES | COc1cnnc(CO)c1.COc1cnnc(Cn2ccnc2C)c1 |
| InChI | InChI=1S/C10H12N4O.C6H8N2O2/c1-8-11-3-4-14(8)7-9-5-10(15-2)6-12-13-9;1-10-6-2-5(4-9)8-7-3-6/h3-6H,7H2,1-2H3;2-3,9H,4H2,1H3 |
| InChIKey | JUNPMCRGMMHUNO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |