About N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine
N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine (PubChem CID 159028585) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine.
Molecular Properties
| Compound Name | N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine |
| PubChem CID | 159028585 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine |
| SMILES | CCC(CC)=NC.CCC(CC)=NO |
| InChI | InChI=1S/C6H13N.C5H11NO/c1-4-6(5-2)7-3;1-3-5(4-2)6-7/h4-5H2,1-3H3;7H,3-4H2,1-2H3 |
| InChIKey | JUOXEIMPHXPNTB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine?
The IUPAC name of N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine (CID 159028585) is N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine.
What is the SMILES notation for N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine?
The canonical SMILES for N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine is CCC(CC)=NC.CCC(CC)=NO.
What is the InChIKey of N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine?
The InChIKey is JUOXEIMPHXPNTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H11NO/c1-4-6(5-2)7-3;1-3-5(4-2)6-7/h4-5H2,1-3H3;7H,3-4H2,1-2H3.
What are the key properties of N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine?
N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine has a molecular weight of 200.33 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpentan-3-imine;N-pentan-3-ylidenehydroxylamine is sourced from PubChem (CID 159028585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).