About 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane
4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane (PubChem CID 159028930) has the molecular formula C18H26FIO4S
and a molecular weight of 484.37 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane.
Molecular Properties
| Compound Name | 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane |
| PubChem CID | 159028930 |
| Molecular Formula | C18H26FIO4S |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane |
| SMILES | ICC1CCOCC1.O=S(=O)(CC1CCOCC1)c1ccccc1F |
| InChI | InChI=1S/C12H15FO3S.C6H11IO/c13-11-3-1-2-4-12(11)17(14,15)9-10-5-7-16-8-6-10;7-5-6-1-3-8-4-2-6/h1-4,10H,5-9H2;6H,1-5H2 |
| InChIKey | JUPZDZURWYBFBQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane?
The IUPAC name of 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane (CID 159028930) is 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane.
What is the SMILES notation for 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane?
The canonical SMILES for 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane is ICC1CCOCC1.O=S(=O)(CC1CCOCC1)c1ccccc1F.
What is the InChIKey of 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane?
The InChIKey is JUPZDZURWYBFBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO3S.C6H11IO/c13-11-3-1-2-4-12(11)17(14,15)9-10-5-7-16-8-6-10;7-5-6-1-3-8-4-2-6/h1-4,10H,5-9H2;6H,1-5H2.
What are the key properties of 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane?
4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane has a molecular weight of 484.37 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-fluorophenyl)sulfonylmethyl]oxane;4-(iodomethyl)oxane is sourced from PubChem (CID 159028930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).