C25H25N2O3S+ — CID 159029330
6-cyclohexyl-4-[(1-hydroxypyridin-1-ium-4-yl)methyl]-5-phenylthieno[3,2-b]pyrrole-2-carboxylic acid (PubChem CID 159029330) has the molecular formula C25H25N2O3S+ and a molecular weight of 433.55 g/mol. Its IUPAC name is 6-cyclohexyl-4-[(1-hydroxypyridin-1-ium-4-yl)methyl]-5-phenylthieno[3,2-b]pyrrole-2-carboxylic acid.
| Compound Name | 6-cyclohexyl-4-[(1-hydroxypyridin-1-ium-4-yl)methyl]-5-phenylthieno[3,2-b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 159029330 |
| Molecular Formula | C25H25N2O3S+ |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 6-cyclohexyl-4-[(1-hydroxypyridin-1-ium-4-yl)methyl]-5-phenylthieno[3,2-b]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)c(C1CCCCC1)c(-c1ccccc1)n2Cc1cc[n+](O)cc1 |
| InChI | InChI=1S/C25H24N2O3S/c28-25(29)21-15-20-24(31-21)22(18-7-3-1-4-8-18)23(19-9-5-2-6-10-19)27(20)16-17-11-13-26(30)14-12-17/h2,5-6,9-15,18H,1,3-4,7-8,16H2,(H-,28,29,30)/p+1 |
| InChIKey | JURHCHOLSVSGAA-UHFFFAOYSA-O |
| XLogP | 5.69 |
| TPSA | 66.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|