About (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine
(6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine (PubChem CID 159029882) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine.
Analyze (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine?
The IUPAC name of (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine (CID 159029882) is (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine.
What is the SMILES notation for (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine?
The canonical SMILES for (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine is C=C1N(C)/C=C\C=NCN1C.
What is the InChIKey of (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine?
The InChIKey is OXWLITGIXIDDCU-LSWUTZEOSA-N. The full InChI is InChI=1S/C8H13N3/c1-8-10(2)6-4-5-9-7-11(8)3/h4-6H,1,7H2,2-3H3/b6-4-,9-5?.
What are the key properties of (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine?
(6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine has a molecular weight of 151.21 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-3,5-dimethyl-4-methylidene-2H-1,3,5-triazocine is sourced from PubChem (CID 159029882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).