C50H42BCl4NO4S3 — CID 159031555
(3,4-dichlorophenyl)boronic acid;2-[1-(3,4-dichlorophenyl)ethyl]-9H-thioxanthene;N-[(4-methylphenyl)sulfonylmethyl]-1-(9H-thioxanthen-2-yl)ethanimine (PubChem CID 159031555) has the molecular formula C50H42BCl4NO4S3 and a molecular weight of 969.71 g/mol. Its IUPAC name is (3,4-dichlorophenyl)boronic acid;2-[1-(3,4-dichlorophenyl)ethyl]-9H-thioxanthene;N-[(4-methylphenyl)sulfonylmethyl]-1-(9H-thioxanthen-2-yl)ethanimine.
| Compound Name | (3,4-dichlorophenyl)boronic acid;2-[1-(3,4-dichlorophenyl)ethyl]-9H-thioxanthene;N-[(4-methylphenyl)sulfonylmethyl]-1-(9H-thioxanthen-2-yl)ethanimine |
|---|---|
| PubChem CID | 159031555 |
| Molecular Formula | C50H42BCl4NO4S3 |
| Molecular Weight | 969.71 g/mol |
| Exact Mass | 967.11 |
| IUPAC Name | (3,4-dichlorophenyl)boronic acid;2-[1-(3,4-dichlorophenyl)ethyl]-9H-thioxanthene;N-[(4-methylphenyl)sulfonylmethyl]-1-(9H-thioxanthen-2-yl)ethanimine |
| SMILES | CC(=NCS(=O)(=O)c1ccc(C)cc1)c1ccc2c(c1)Cc1ccccc1S2.CC(c1ccc(Cl)c(Cl)c1)c1ccc2c(c1)Cc1ccccc1S2.OB(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H21NO2S2.C21H16Cl2S.C6H5BCl2O2/c1-16-7-10-21(11-8-16)28(25,26)15-24-17(2)18-9-12-23-20(13-18)14-19-5-3-4-6-22(19)27-23;1-13(15-6-8-18(22)19(23)12-15)14-7-9-21-17(10-14)11-16-4-2-3-5-20(16)24-21;8-5-2-1-4(7(10)11)3-6(5)9/h3-13H,14-15H2,1-2H3;2-10,12-13H,11H2,1H3;1-3,10-11H |
| InChIKey | JUYKFTARQHPGRD-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.71 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|