About CID 159032045
CID 159032045 (PubChem CID 159032045) has the molecular formula C10H21BNO2
and a molecular weight of 198.09 g/mol.
Molecular Properties
| Compound Name | CID 159032045 |
| PubChem CID | 159032045 |
| Molecular Formula | C10H21BNO2 |
| Molecular Weight | 198.09 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | — |
| SMILES | C/N=C(\C)CC(=O)OC(C)C.CC.[B] |
| InChI | InChI=1S/C8H15NO2.C2H6.B/c1-6(2)11-8(10)5-7(3)9-4;1-2;/h6H,5H2,1-4H3;1-2H3;/b9-7+;; |
| InChIKey | YURCVQAWWSFZSR-OJYIHNBOSA-N |
| XLogP | 2.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.09 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 159032045 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159032045?
The IUPAC name of CID 159032045 (CID 159032045) is not available.
What is the SMILES notation for CID 159032045?
The canonical SMILES for CID 159032045 is C/N=C(\C)CC(=O)OC(C)C.CC.[B].
What is the InChIKey of CID 159032045?
The InChIKey is YURCVQAWWSFZSR-OJYIHNBOSA-N. The full InChI is InChI=1S/C8H15NO2.C2H6.B/c1-6(2)11-8(10)5-7(3)9-4;1-2;/h6H,5H2,1-4H3;1-2H3;/b9-7+;;.
What are the key properties of CID 159032045?
CID 159032045 has a molecular weight of 198.09 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159032045 is sourced from PubChem (CID 159032045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).