C27H30ClF3N4 — CID 159032503
7-chloro-4,4-dimethyl-2,3-dihydro-1H-1,8-naphthyridine;4,4-dimethyl-7-[3-(trifluoromethyl)phenyl]-2,3-dihydro-1H-1,8-naphthyridine (PubChem CID 159032503) has the molecular formula C27H30ClF3N4 and a molecular weight of 503.01 g/mol. Its IUPAC name is 7-chloro-4,4-dimethyl-2,3-dihydro-1H-1,8-naphthyridine;4,4-dimethyl-7-[3-(trifluoromethyl)phenyl]-2,3-dihydro-1H-1,8-naphthyridine.
| Compound Name | 7-chloro-4,4-dimethyl-2,3-dihydro-1H-1,8-naphthyridine;4,4-dimethyl-7-[3-(trifluoromethyl)phenyl]-2,3-dihydro-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 159032503 |
| Molecular Formula | C27H30ClF3N4 |
| Molecular Weight | 503.01 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 7-chloro-4,4-dimethyl-2,3-dihydro-1H-1,8-naphthyridine;4,4-dimethyl-7-[3-(trifluoromethyl)phenyl]-2,3-dihydro-1H-1,8-naphthyridine |
| SMILES | CC1(C)CCNc2nc(-c3cccc(C(F)(F)F)c3)ccc21.CC1(C)CCNc2nc(Cl)ccc21 |
| InChI | InChI=1S/C17H17F3N2.C10H13ClN2/c1-16(2)8-9-21-15-13(16)6-7-14(22-15)11-4-3-5-12(10-11)17(18,19)20;1-10(2)5-6-12-9-7(10)3-4-8(11)13-9/h3-7,10H,8-9H2,1-2H3,(H,21,22);3-4H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | JVBAYJUCZFKNMA-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.01 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|