About acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide
acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide (PubChem CID 159033752) has the molecular formula C20H24Cl2N2O6
and a molecular weight of 459.33 g/mol. Its IUPAC name is acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide.
Molecular Properties
| Compound Name | acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide |
| PubChem CID | 159033752 |
| Molecular Formula | C20H24Cl2N2O6 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1cc(C)cc(Cl)c1.CC(=O)OOOC(C)=O.Cc1cc(N)cc(Cl)c1 |
| InChI | InChI=1S/C9H10ClNO.C7H8ClN.C4H6O5/c1-6-3-8(10)5-9(4-6)11-7(2)12;1-5-2-6(8)4-7(9)3-5;1-3(5)7-9-8-4(2)6/h3-5H,1-2H3,(H,11,12);2-4H,9H2,1H3;1-2H3 |
| InChIKey | JVEXSYWANNRAKE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide?
The IUPAC name of acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide (CID 159033752) is acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide.
What is the SMILES notation for acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide?
The canonical SMILES for acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide is CC(=O)Nc1cc(C)cc(Cl)c1.CC(=O)OOOC(C)=O.Cc1cc(N)cc(Cl)c1.
What is the InChIKey of acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide?
The InChIKey is JVEXSYWANNRAKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO.C7H8ClN.C4H6O5/c1-6-3-8(10)5-9(4-6)11-7(2)12;1-5-2-6(8)4-7(9)3-5;1-3(5)7-9-8-4(2)6/h3-5H,1-2H3,(H,11,12);2-4H,9H2,1H3;1-2H3.
What are the key properties of acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide?
acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide has a molecular weight of 459.33 g/mol, XLogP of 4.80, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxy ethaneperoxoate;3-chloro-5-methylaniline;N-(3-chloro-5-methylphenyl)acetamide is sourced from PubChem (CID 159033752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).