C31H28Cl2N4O2S2 — CID 159034770
dichloromethane;5-methyl-4-methylsulfanyl-1,10-phenanthroline-2-carbaldehyde;(5-methyl-4-methylsulfanyl-1,10-phenanthrolin-2-yl)methanol (PubChem CID 159034770) has the molecular formula C31H28Cl2N4O2S2 and a molecular weight of 623.63 g/mol. Its IUPAC name is dichloromethane;5-methyl-4-methylsulfanyl-1,10-phenanthroline-2-carbaldehyde;(5-methyl-4-methylsulfanyl-1,10-phenanthrolin-2-yl)methanol.
| Compound Name | dichloromethane;5-methyl-4-methylsulfanyl-1,10-phenanthroline-2-carbaldehyde;(5-methyl-4-methylsulfanyl-1,10-phenanthrolin-2-yl)methanol |
|---|---|
| PubChem CID | 159034770 |
| Molecular Formula | C31H28Cl2N4O2S2 |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | dichloromethane;5-methyl-4-methylsulfanyl-1,10-phenanthroline-2-carbaldehyde;(5-methyl-4-methylsulfanyl-1,10-phenanthrolin-2-yl)methanol |
| SMILES | CSc1cc(C=O)nc2c1c(C)cc1cccnc12.CSc1cc(CO)nc2c1c(C)cc1cccnc12.ClCCl |
| InChI | InChI=1S/C15H14N2OS.C15H12N2OS.CH2Cl2/c2*1-9-6-10-4-3-5-16-14(10)15-13(9)12(19-2)7-11(8-18)17-15;2-1-3/h3-7,18H,8H2,1-2H3;3-8H,1-2H3;1H2 |
| InChIKey | JVICNIDCYPFTDS-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|