C26H20N4O2 — CID 159035028
[5-[6-(4-isocyanophenyl)-1-methyl-4,5-dihydro-3H-pyrrolo[3,4-d][1]benzazepin-8-yl]-2-pyridinyl] formate (PubChem CID 159035028) has the molecular formula C26H20N4O2 and a molecular weight of 420.47 g/mol. Its IUPAC name is [5-[6-(4-isocyanophenyl)-1-methyl-4,5-dihydro-3H-pyrrolo[3,4-d][1]benzazepin-8-yl]-2-pyridinyl] formate.
| Compound Name | [5-[6-(4-isocyanophenyl)-1-methyl-4,5-dihydro-3H-pyrrolo[3,4-d][1]benzazepin-8-yl]-2-pyridinyl] formate |
|---|---|
| PubChem CID | 159035028 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [5-[6-(4-isocyanophenyl)-1-methyl-4,5-dihydro-3H-pyrrolo[3,4-d][1]benzazepin-8-yl]-2-pyridinyl] formate |
| SMILES | [C-]#[N+]c1ccc(N2CCC3=C(C(C)=NC3)c3ccc(-c4ccc(OC=O)nc4)cc32)cc1 |
| InChI | InChI=1S/C26H20N4O2/c1-17-26-20(15-28-17)11-12-30(22-7-5-21(27-2)6-8-22)24-13-18(3-9-23(24)26)19-4-10-25(29-14-19)32-16-31/h3-10,13-14,16H,11-12,15H2,1H3 |
| InChIKey | GXXGVXGCEVDFMA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 59.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|