C30H26FN3O2S — CID 159035467
9-cyclopropyl-6-fluoro-7-[1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]-[1,2]thiazolo[5,4-b]quinoline-3,4-dione (PubChem CID 159035467) has the molecular formula C30H26FN3O2S and a molecular weight of 511.62 g/mol. Its IUPAC name is 9-cyclopropyl-6-fluoro-7-[1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]-[1,2]thiazolo[5,4-b]quinoline-3,4-dione.
| Compound Name | 9-cyclopropyl-6-fluoro-7-[1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
|---|---|
| PubChem CID | 159035467 |
| Molecular Formula | C30H26FN3O2S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 9-cyclopropyl-6-fluoro-7-[1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinolin-6-yl]-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
| SMILES | O=c1[nH]sc2c1c(=O)c1cc(F)c(-c3ccc4c(c3)CCNC4CCc3ccccc3)cc1n2C1CC1 |
| InChI | InChI=1S/C30H26FN3O2S/c31-24-15-23-26(34(20-8-9-20)30-27(28(23)35)29(36)33-37-30)16-22(24)18-7-10-21-19(14-18)12-13-32-25(21)11-6-17-4-2-1-3-5-17/h1-5,7,10,14-16,20,25,32H,6,8-9,11-13H2,(H,33,36) |
| InChIKey | JVKCJJAAYDZFDG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |