About 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide
4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide (PubChem CID 159035866) has the molecular formula C18H21BrN2O
and a molecular weight of 361.28 g/mol. Its IUPAC name is 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide.
Molecular Properties
| Compound Name | 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide |
| PubChem CID | 159035866 |
| Molecular Formula | C18H21BrN2O |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide |
| SMILES | COc1cc(N(C)C)ccc1/C=C1\CC[n+]2ccccc21.[Br-] |
| InChI | InChI=1S/C18H21N2O.BrH/c1-19(2)16-8-7-15(18(13-16)21-3)12-14-9-11-20-10-5-4-6-17(14)20;/h4-8,10,12-13H,9,11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UDVKVJITYOFWNP-UHFFFAOYSA-M |
| XLogP | -0.00 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide?
The IUPAC name of 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide (CID 159035866) is 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide.
What is the SMILES notation for 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide?
The canonical SMILES for 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide is COc1cc(N(C)C)ccc1/C=C1\CC[n+]2ccccc21.[Br-].
What is the InChIKey of 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide?
The InChIKey is UDVKVJITYOFWNP-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H21N2O.BrH/c1-19(2)16-8-7-15(18(13-16)21-3)12-14-9-11-20-10-5-4-6-17(14)20;/h4-8,10,12-13H,9,11H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide?
4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide has a molecular weight of 361.28 g/mol, XLogP of -0.00, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2,3-dihydroindolizin-4-ium-1-ylidenemethyl]-3-methoxy-N,N-dimethylaniline bromide is sourced from PubChem (CID 159035866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).