C24H42N4O6 — CID 159036149
(7S)-4-[3-(diaminomethylideneamino)propyl]-9-methyl-7-[[(2R)-2-(2-methylpropyl)-4-oxopentanoyl]amino]-3,6-dioxodecanoic acid (PubChem CID 159036149) has the molecular formula C24H42N4O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is (7S)-4-[3-(diaminomethylideneamino)propyl]-9-methyl-7-[[(2R)-2-(2-methylpropyl)-4-oxopentanoyl]amino]-3,6-dioxodecanoic acid.
| Compound Name | (7S)-4-[3-(diaminomethylideneamino)propyl]-9-methyl-7-[[(2R)-2-(2-methylpropyl)-4-oxopentanoyl]amino]-3,6-dioxodecanoic acid |
|---|---|
| PubChem CID | 159036149 |
| Molecular Formula | C24H42N4O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | (7S)-4-[3-(diaminomethylideneamino)propyl]-9-methyl-7-[[(2R)-2-(2-methylpropyl)-4-oxopentanoyl]amino]-3,6-dioxodecanoic acid |
| SMILES | CC(=O)C[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)CC(CCCN=C(N)N)C(=O)CC(=O)O |
| InChI | InChI=1S/C24H42N4O6/c1-14(2)9-18(11-16(5)29)23(34)28-19(10-15(3)4)21(31)12-17(20(30)13-22(32)33)7-6-8-27-24(25)26/h14-15,17-19H,6-13H2,1-5H3,(H,28,34)(H,32,33)(H4,25,26,27)/t17?,18-,19+/m1/s1 |
| InChIKey | JVMDQSNJNDFVQO-CPSIJMPNSA-N |
| XLogP | 1.83 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|