About 2H-thiochromene;urea
2H-thiochromene;urea (PubChem CID 159036759) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is 2H-thiochromene;urea.
Molecular Properties
| Compound Name | 2H-thiochromene;urea |
| PubChem CID | 159036759 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2H-thiochromene;urea |
| SMILES | C1=Cc2ccccc2SC1.NC(N)=O |
| InChI | InChI=1S/C9H8S.CH4N2O/c1-2-6-9-8(4-1)5-3-7-10-9;2-1(3)4/h1-6H,7H2;(H4,2,3,4) |
| InChIKey | JVOAJKIOPHICSN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-thiochromene;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-thiochromene;urea?
The IUPAC name of 2H-thiochromene;urea (CID 159036759) is 2H-thiochromene;urea.
What is the SMILES notation for 2H-thiochromene;urea?
The canonical SMILES for 2H-thiochromene;urea is C1=Cc2ccccc2SC1.NC(N)=O.
What is the InChIKey of 2H-thiochromene;urea?
The InChIKey is JVOAJKIOPHICSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8S.CH4N2O/c1-2-6-9-8(4-1)5-3-7-10-9;2-1(3)4/h1-6H,7H2;(H4,2,3,4).
What are the key properties of 2H-thiochromene;urea?
2H-thiochromene;urea has a molecular weight of 208.29 g/mol, XLogP of 1.83, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-thiochromene;urea is sourced from PubChem (CID 159036759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).