About CID 159037812
CID 159037812 (PubChem CID 159037812) has the molecular formula C41H40N4O11S
and a molecular weight of 796.85 g/mol.
Molecular Properties
| Compound Name | CID 159037812 |
| PubChem CID | 159037812 |
| Molecular Formula | C41H40N4O11S |
| Molecular Weight | 796.85 g/mol |
| Exact Mass | 796.24 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccccc2[N+]2(CC2C(=O)[O-])[C@@]12C=CC1=C(CCC([N+](=O)[O-])=C1)O2.CC1(C)c2ccccc2[N+]2(CC2S(=O)(=O)[O-])[C@@]12C=CC1=C(CCC([N+](=O)[O-])=C1)O2 |
| InChI | InChI=1S/C21H20N2O5.C20H20N2O6S/c1-20(2)15-5-3-4-6-16(15)23(12-17(23)19(24)25)21(20)10-9-13-11-14(22(26)27)7-8-18(13)28-21;1-19(2)15-5-3-4-6-16(15)22(12-18(22)29(25,26)27)20(19)10-9-13-11-14(21(23)24)7-8-17(13)28-20/h3-6,9-11,17H,7-8,12H2,1-2H3;3-6,9-11,18H,7-8,12H2,1-2H3/t17?,21-,23?;18?,20-,22?/m11/s1 |
| InChIKey | MQGZGIADVUWHTE-FYDAEQHQSA-N |
| XLogP | 4.57 |
| TPSA | 202.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 796.85 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 159037812 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159037812?
The IUPAC name of CID 159037812 (CID 159037812) is not available.
What is the SMILES notation for CID 159037812?
The canonical SMILES for CID 159037812 is CC1(C)c2ccccc2[N+]2(CC2C(=O)[O-])[C@@]12C=CC1=C(CCC([N+](=O)[O-])=C1)O2.CC1(C)c2ccccc2[N+]2(CC2S(=O)(=O)[O-])[C@@]12C=CC1=C(CCC([N+](=O)[O-])=C1)O2.
What is the InChIKey of CID 159037812?
The InChIKey is MQGZGIADVUWHTE-FYDAEQHQSA-N. The full InChI is InChI=1S/C21H20N2O5.C20H20N2O6S/c1-20(2)15-5-3-4-6-16(15)23(12-17(23)19(24)25)21(20)10-9-13-11-14(22(26)27)7-8-18(13)28-21;1-19(2)15-5-3-4-6-16(15)22(12-18(22)29(25,26)27)20(19)10-9-13-11-14(21(23)24)7-8-17(13)28-20/h3-6,9-11,17H,7-8,12H2,1-2H3;3-6,9-11,18H,7-8,12H2,1-2H3/t17?,21-,23?;18?,20-,22?/m11/s1.
What are the key properties of CID 159037812?
CID 159037812 has a molecular weight of 796.85 g/mol, XLogP of 4.57, 4 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159037812 is sourced from PubChem (CID 159037812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).