C21H25N5O — CID 159038311
5-[(4-aminophenyl)methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide (PubChem CID 159038311) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 5-[(4-aminophenyl)methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(4-aminophenyl)methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 159038311 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 5-[(4-aminophenyl)methyl]-3-[(3,4,5-trimethylphenyl)methylamino]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(CNc2n[nH]c(Cc3ccc(N)cc3)c2C(N)=O)cc(C)c1C |
| InChI | InChI=1S/C21H25N5O/c1-12-8-16(9-13(2)14(12)3)11-24-21-19(20(23)27)18(25-26-21)10-15-4-6-17(22)7-5-15/h4-9H,10-11,22H2,1-3H3,(H2,23,27)(H2,24,25,26) |
| InChIKey | MYPQDOBZTBPOFK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|