About 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane
2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane (PubChem CID 159039422) has the molecular formula C20H33N3O5S
and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane.
Molecular Properties
| Compound Name | 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane |
| PubChem CID | 159039422 |
| Molecular Formula | C20H33N3O5S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane |
| SMILES | C.C.CC(=O)OCCOc1cc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)n(C)n1 |
| InChI | InChI=1S/C18H25N3O5S.2CH4/c1-13(22)25-10-11-26-17-12-16(21(5)19-17)20-27(23,24)15-8-6-14(7-9-15)18(2,3)4;;/h6-9,12,20H,10-11H2,1-5H3;2*1H4 |
| InChIKey | JVWCYHSBGJNOJY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane?
The IUPAC name of 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane (CID 159039422) is 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane.
What is the SMILES notation for 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane?
The canonical SMILES for 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane is C.C.CC(=O)OCCOc1cc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)n(C)n1.
What is the InChIKey of 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane?
The InChIKey is JVWCYHSBGJNOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O5S.2CH4/c1-13(22)25-10-11-26-17-12-16(21(5)19-17)20-27(23,24)15-8-6-14(7-9-15)18(2,3)4;;/h6-9,12,20H,10-11H2,1-5H3;2*1H4.
What are the key properties of 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane?
2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane has a molecular weight of 427.57 g/mol, XLogP of 3.73, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(4-tert-butylphenyl)sulfonylamino]-1-methylpyrazol-3-yl]oxyethyl acetate;methane is sourced from PubChem (CID 159039422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).