C55H74N4O7 — CID 159039914
[2-[2-[2-[2-[bis(2-methoxyethyl)amino]ethoxy]ethoxy]ethoxy]-3-(hydroxymethyl)phenyl]methanol;N,N-dibutylaniline;2,4,5-triphenyl-1H-imidazole (PubChem CID 159039914) has the molecular formula C55H74N4O7 and a molecular weight of 903.22 g/mol. Its IUPAC name is [2-[2-[2-[2-[bis(2-methoxyethyl)amino]ethoxy]ethoxy]ethoxy]-3-(hydroxymethyl)phenyl]methanol;N,N-dibutylaniline;2,4,5-triphenyl-1H-imidazole.
| Compound Name | [2-[2-[2-[2-[bis(2-methoxyethyl)amino]ethoxy]ethoxy]ethoxy]-3-(hydroxymethyl)phenyl]methanol;N,N-dibutylaniline;2,4,5-triphenyl-1H-imidazole |
|---|---|
| PubChem CID | 159039914 |
| Molecular Formula | C55H74N4O7 |
| Molecular Weight | 903.22 g/mol |
| Exact Mass | 902.56 |
| IUPAC Name | [2-[2-[2-[2-[bis(2-methoxyethyl)amino]ethoxy]ethoxy]ethoxy]-3-(hydroxymethyl)phenyl]methanol;N,N-dibutylaniline;2,4,5-triphenyl-1H-imidazole |
| SMILES | CCCCN(CCCC)c1ccccc1.COCCN(CCOC)CCOCCOCCOc1c(CO)cccc1CO.c1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C21H16N2.C20H35NO7.C14H23N/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23-21(22-19)18-14-8-3-9-15-18;1-24-9-6-21(7-10-25-2)8-11-26-12-13-27-14-15-28-20-18(16-22)4-3-5-19(20)17-23;1-3-5-12-15(13-6-4-2)14-10-8-7-9-11-14/h1-15H,(H,22,23);3-5,22-23H,6-17H2,1-2H3;7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | JVXQYANWRDATIJ-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.22 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|