About CID 159039916
CID 159039916 (PubChem CID 159039916) has the molecular formula C5H6N2Na2O3
and a molecular weight of 188.09 g/mol.
Molecular Properties
| Compound Name | CID 159039916 |
| PubChem CID | 159039916 |
| Molecular Formula | C5H6N2Na2O3 |
| Molecular Weight | 188.09 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | — |
| SMILES | COc1c(O)nc[nH]c1=O.[Na].[Na] |
| InChI | InChI=1S/C5H6N2O3.2Na/c1-10-3-4(8)6-2-7-5(3)9;;/h2H,1H3,(H2,6,7,8,9);; |
| InChIKey | JVXRCPLFBHIDMU-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.09 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 159039916 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159039916?
The IUPAC name of CID 159039916 (CID 159039916) is not available.
What is the SMILES notation for CID 159039916?
The canonical SMILES for CID 159039916 is COc1c(O)nc[nH]c1=O.[Na].[Na].
What is the InChIKey of CID 159039916?
The InChIKey is JVXRCPLFBHIDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3.2Na/c1-10-3-4(8)6-2-7-5(3)9;;/h2H,1H3,(H2,6,7,8,9);;.
What are the key properties of CID 159039916?
CID 159039916 has a molecular weight of 188.09 g/mol, XLogP of -1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159039916 is sourced from PubChem (CID 159039916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).