C18H24N4OS — CID 159040479
(9aR)-2-(5-cyclohexyl-1,3-thiazol-2-yl)-8-ethynyl-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-1-one (PubChem CID 159040479) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (9aR)-2-(5-cyclohexyl-1,3-thiazol-2-yl)-8-ethynyl-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-1-one.
| Compound Name | (9aR)-2-(5-cyclohexyl-1,3-thiazol-2-yl)-8-ethynyl-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 159040479 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (9aR)-2-(5-cyclohexyl-1,3-thiazol-2-yl)-8-ethynyl-3,4,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-1-one |
| SMILES | C#CN1CCN2CCN(c3ncc(C4CCCCC4)s3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C18H24N4OS/c1-2-20-8-9-21-10-11-22(17(23)15(21)13-20)18-19-12-16(24-18)14-6-4-3-5-7-14/h1,12,14-15H,3-11,13H2/t15-/m1/s1 |
| InChIKey | BWVCCPGGNFYZBQ-OAHLLOKOSA-N |
| XLogP | 2.11 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|