About 1-methylpyrrole-2,5-dione;toluene
1-methylpyrrole-2,5-dione;toluene (PubChem CID 159040601) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-methylpyrrole-2,5-dione;toluene.
Molecular Properties
| Compound Name | 1-methylpyrrole-2,5-dione;toluene |
| PubChem CID | 159040601 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1-methylpyrrole-2,5-dione;toluene |
| SMILES | CN1C(=O)C=CC1=O.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C5H5NO2/c1-7-5-3-2-4-6-7;1-6-4(7)2-3-5(6)8/h2-6H,1H3;2-3H,1H3 |
| InChIKey | JVZTVDGCMIRSBS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrole-2,5-dione;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrole-2,5-dione;toluene?
The IUPAC name of 1-methylpyrrole-2,5-dione;toluene (CID 159040601) is 1-methylpyrrole-2,5-dione;toluene.
What is the SMILES notation for 1-methylpyrrole-2,5-dione;toluene?
The canonical SMILES for 1-methylpyrrole-2,5-dione;toluene is CN1C(=O)C=CC1=O.Cc1ccccc1.
What is the InChIKey of 1-methylpyrrole-2,5-dione;toluene?
The InChIKey is JVZTVDGCMIRSBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C5H5NO2/c1-7-5-3-2-4-6-7;1-6-4(7)2-3-5(6)8/h2-6H,1H3;2-3H,1H3.
What are the key properties of 1-methylpyrrole-2,5-dione;toluene?
1-methylpyrrole-2,5-dione;toluene has a molecular weight of 203.24 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrole-2,5-dione;toluene is sourced from PubChem (CID 159040601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).