About ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline
ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline (PubChem CID 159043395) has the molecular formula C30H36N2
and a molecular weight of 424.63 g/mol. Its IUPAC name is ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline.
Molecular Properties
| Compound Name | ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline |
| PubChem CID | 159043395 |
| Molecular Formula | C30H36N2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline |
| SMILES | CC(c1ccccc1)N(C)c1ccccc1.CCc1ccccc1.CNc1ccccc1 |
| InChI | InChI=1S/C15H17N.C8H10.C7H9N/c1-13(14-9-5-3-6-10-14)16(2)15-11-7-4-8-12-15;1-2-8-6-4-3-5-7-8;1-8-7-5-3-2-4-6-7/h3-13H,1-2H3;3-7H,2H2,1H3;2-6,8H,1H3 |
| InChIKey | JWIXRSNBOOPBPJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline?
The IUPAC name of ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline (CID 159043395) is ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline.
What is the SMILES notation for ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline?
The canonical SMILES for ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline is CC(c1ccccc1)N(C)c1ccccc1.CCc1ccccc1.CNc1ccccc1.
What is the InChIKey of ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline?
The InChIKey is JWIXRSNBOOPBPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N.C8H10.C7H9N/c1-13(14-9-5-3-6-10-14)16(2)15-11-7-4-8-12-15;1-2-8-6-4-3-5-7-8;1-8-7-5-3-2-4-6-7/h3-13H,1-2H3;3-7H,2H2,1H3;2-6,8H,1H3.
What are the key properties of ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline?
ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline has a molecular weight of 424.63 g/mol, XLogP of 7.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;N-methylaniline;N-methyl-N-(1-phenylethyl)aniline is sourced from PubChem (CID 159043395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).