About 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene
7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene (PubChem CID 15904382) has the molecular formula C17H20
and a molecular weight of 224.35 g/mol. Its IUPAC name is 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene.
Molecular Properties
| Compound Name | 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene |
| PubChem CID | 15904382 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene |
| SMILES | CC1=C(c2ccccc2)C2CCC1C1CCC21 |
| InChI | InChI=1S/C17H20/c1-11-13-7-10-16(15-9-8-14(13)15)17(11)12-5-3-2-4-6-12/h2-6,13-16H,7-10H2,1H3 |
| InChIKey | MUCBRPLDZTVXIW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene?
The IUPAC name of 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene (CID 15904382) is 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene.
What is the SMILES notation for 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene?
The canonical SMILES for 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene is CC1=C(c2ccccc2)C2CCC1C1CCC21.
What is the InChIKey of 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene?
The InChIKey is MUCBRPLDZTVXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20/c1-11-13-7-10-16(15-9-8-14(13)15)17(11)12-5-3-2-4-6-12/h2-6,13-16H,7-10H2,1H3.
What are the key properties of 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene?
7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene has a molecular weight of 224.35 g/mol, XLogP of 4.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-8-phenyltricyclo[4.2.2.02,5]dec-7-ene is sourced from PubChem (CID 15904382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).