C30H41Br3 — CID 159044062
6-bromo-7-(bromomethyl)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene;6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene (PubChem CID 159044062) has the molecular formula C30H41Br3 and a molecular weight of 641.37 g/mol. Its IUPAC name is 6-bromo-7-(bromomethyl)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene;6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene.
| Compound Name | 6-bromo-7-(bromomethyl)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene;6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 159044062 |
| Molecular Formula | C30H41Br3 |
| Molecular Weight | 641.37 g/mol |
| Exact Mass | 638.08 |
| IUPAC Name | 6-bromo-7-(bromomethyl)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene;6-bromo-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
| SMILES | CC1(C)CCC(C)(C)c2cc(CBr)c(Br)cc21.Cc1cc2c(cc1Br)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C15H20Br2.C15H21Br/c1-14(2)5-6-15(3,4)12-8-13(17)10(9-16)7-11(12)14;1-10-8-11-12(9-13(10)16)15(4,5)7-6-14(11,2)3/h7-8H,5-6,9H2,1-4H3;8-9H,6-7H2,1-5H3 |
| InChIKey | JWKWYLZJHGQQPA-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.37 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|