C25H38F6N4O9 — CID 159044169
dimethyl propanedioate;methyl 3-[[(2S)-1-amino-1-oxobutan-2-yl]-(4,4,4-trifluorobut-2-enyl)amino]-3-oxopropanoate;(2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide (PubChem CID 159044169) has the molecular formula C25H38F6N4O9 and a molecular weight of 652.59 g/mol. Its IUPAC name is dimethyl propanedioate;methyl 3-[[(2S)-1-amino-1-oxobutan-2-yl]-(4,4,4-trifluorobut-2-enyl)amino]-3-oxopropanoate;(2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide.
| Compound Name | dimethyl propanedioate;methyl 3-[[(2S)-1-amino-1-oxobutan-2-yl]-(4,4,4-trifluorobut-2-enyl)amino]-3-oxopropanoate;(2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide |
|---|---|
| PubChem CID | 159044169 |
| Molecular Formula | C25H38F6N4O9 |
| Molecular Weight | 652.59 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | dimethyl propanedioate;methyl 3-[[(2S)-1-amino-1-oxobutan-2-yl]-(4,4,4-trifluorobut-2-enyl)amino]-3-oxopropanoate;(2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide |
| SMILES | CC[C@@H](C(N)=O)N(CC=CC(F)(F)F)C(=O)CC(=O)OC.CC[C@H](NCC=CC(F)(F)F)C(N)=O.COC(=O)CC(=O)OC |
| InChI | InChI=1S/C12H17F3N2O4.C8H13F3N2O.C5H8O4/c1-3-8(11(16)20)17(6-4-5-12(13,14)15)9(18)7-10(19)21-2;1-2-6(7(12)14)13-5-3-4-8(9,10)11;1-8-4(6)3-5(7)9-2/h4-5,8H,3,6-7H2,1-2H3,(H2,16,20);3-4,6,13H,2,5H2,1H3,(H2,12,14);3H2,1-2H3/t8-;6-;/m00./s1 |
| InChIKey | JWLFPCWDHHMCPA-MAQZFPPUSA-N |
| XLogP | 1.44 |
| TPSA | 197.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.59 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|