C9H8F3NaO3S — CID 159045735
sodium 6-(3,3,3-trifluoropropylidene)cyclohexa-2,4-diene-1-sulfonate (PubChem CID 159045735) has the molecular formula C9H8F3NaO3S and a molecular weight of 276.21 g/mol. Its IUPAC name is sodium 6-(3,3,3-trifluoropropylidene)cyclohexa-2,4-diene-1-sulfonate.
| Compound Name | sodium 6-(3,3,3-trifluoropropylidene)cyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 159045735 |
| Molecular Formula | C9H8F3NaO3S |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | sodium 6-(3,3,3-trifluoropropylidene)cyclohexa-2,4-diene-1-sulfonate |
| SMILES | O=S(=O)([O-])C1C=CC=CC1=CCC(F)(F)F.[Na+] |
| InChI | InChI=1S/C9H9F3O3S.Na/c10-9(11,12)6-5-7-3-1-2-4-8(7)16(13,14)15;/h1-5,8H,6H2,(H,13,14,15);/q;+1/p-1 |
| InChIKey | RVWDCMZHFPYQID-UHFFFAOYSA-M |
| XLogP | -1.09 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|