C8H8N5+ — CID 159045899
7-methyl-2,3,9,11-tetraza-6-azoniatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene (PubChem CID 159045899) has the molecular formula C8H8N5+ and a molecular weight of 174.19 g/mol. Its IUPAC name is 7-methyl-2,3,9,11-tetraza-6-azoniatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene.
| Compound Name | 7-methyl-2,3,9,11-tetraza-6-azoniatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene |
|---|---|
| PubChem CID | 159045899 |
| Molecular Formula | C8H8N5+ |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 7-methyl-2,3,9,11-tetraza-6-azoniatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaene |
| SMILES | CC1c2ncncc2-n2ncc[n+]21 |
| InChI | InChI=1S/C8H8N5/c1-6-8-7(4-9-5-10-8)13-11-2-3-12(6)13/h2-6H,1H3/q+1 |
| InChIKey | BPDNOQDZNNVTTQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|