C23H33BrN2OS — CID 159046418
1-(2,6-dimethylphenyl)-3-[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-1-ium-1-yl]pentan-2-one bromide (PubChem CID 159046418) has the molecular formula C23H33BrN2OS and a molecular weight of 465.50 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-1-ium-1-yl]pentan-2-one bromide.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-1-ium-1-yl]pentan-2-one bromide |
|---|---|
| PubChem CID | 159046418 |
| Molecular Formula | C23H33BrN2OS |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[1-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidin-1-ium-1-yl]pentan-2-one bromide |
| SMILES | CCC(C(=O)Cc1c(C)cccc1C)[N+]1(Cc2cnc(C)s2)CCCCC1.[Br-] |
| InChI | InChI=1S/C23H33N2OS.BrH/c1-5-22(23(26)14-21-17(2)10-9-11-18(21)3)25(12-7-6-8-13-25)16-20-15-24-19(4)27-20;/h9-11,15,22H,5-8,12-14,16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PJPHVOKJHXEATJ-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|