C34H60O3 — CID 159046518
(9Z,12Z)-octadeca-9,12-dienal;[(3Z,5E)-tetradeca-3,5-dienyl] acetate (PubChem CID 159046518) has the molecular formula C34H60O3 and a molecular weight of 516.85 g/mol. Its IUPAC name is (9Z,12Z)-octadeca-9,12-dienal;[(3Z,5E)-tetradeca-3,5-dienyl] acetate.
| Compound Name | (9Z,12Z)-octadeca-9,12-dienal;[(3Z,5E)-tetradeca-3,5-dienyl] acetate |
|---|---|
| PubChem CID | 159046518 |
| Molecular Formula | C34H60O3 |
| Molecular Weight | 516.85 g/mol |
| Exact Mass | 516.45 |
| IUPAC Name | (9Z,12Z)-octadeca-9,12-dienal;[(3Z,5E)-tetradeca-3,5-dienyl] acetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC=O.CCCCCCCC/C=C/C=C\CCOC(C)=O |
| InChI | InChI=1S/C18H32O.C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h6-7,9-10,18H,2-5,8,11-17H2,1H3;10-13H,3-9,14-15H2,1-2H3/b7-6-,10-9-;11-10+,13-12- |
| InChIKey | JWSMAJYXKKZPDI-GPJJOGFKSA-N |
| XLogP | 10.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.85 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|