About 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one
4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one (PubChem CID 159047602) has the molecular formula C9H10F2N6O2
and a molecular weight of 272.22 g/mol. Its IUPAC name is 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one |
| PubChem CID | 159047602 |
| Molecular Formula | C9H10F2N6O2 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one |
| SMILES | Cn1cc(F)c(N)nc1=O.Nc1[nH]c(=O)ncc1F |
| InChI | InChI=1S/C5H6FN3O.C4H4FN3O/c1-9-2-3(6)4(7)8-5(9)10;5-2-1-7-4(9)8-3(2)6/h2H,1H3,(H2,7,8,10);1H,(H3,6,7,8,9) |
| InChIKey | JWVTUUVOPQGJOA-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one?
The IUPAC name of 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one (CID 159047602) is 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one.
What is the SMILES notation for 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one?
The canonical SMILES for 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one is Cn1cc(F)c(N)nc1=O.Nc1[nH]c(=O)ncc1F.
What is the InChIKey of 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one?
The InChIKey is JWVTUUVOPQGJOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FN3O.C4H4FN3O/c1-9-2-3(6)4(7)8-5(9)10;5-2-1-7-4(9)8-3(2)6/h2H,1H3,(H2,7,8,10);1H,(H3,6,7,8,9).
What are the key properties of 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one?
4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one has a molecular weight of 272.22 g/mol, XLogP of -1.01, 0 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-fluoro-1-methylpyrimidin-2-one;6-amino-5-fluoro-1H-pyrimidin-2-one is sourced from PubChem (CID 159047602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).