C25H46O8Si — CID 159047894
ethyl 2-[(4S,6R)-2,2-ditert-butyl-6-ethenyl-1,3,2-dioxasilinan-4-yl]acetate;methyl (3S,5R)-3,5-dihydroxyhept-6-enoate (PubChem CID 159047894) has the molecular formula C25H46O8Si and a molecular weight of 502.72 g/mol. Its IUPAC name is ethyl 2-[(4S,6R)-2,2-ditert-butyl-6-ethenyl-1,3,2-dioxasilinan-4-yl]acetate;methyl (3S,5R)-3,5-dihydroxyhept-6-enoate.
| Compound Name | ethyl 2-[(4S,6R)-2,2-ditert-butyl-6-ethenyl-1,3,2-dioxasilinan-4-yl]acetate;methyl (3S,5R)-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 159047894 |
| Molecular Formula | C25H46O8Si |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | ethyl 2-[(4S,6R)-2,2-ditert-butyl-6-ethenyl-1,3,2-dioxasilinan-4-yl]acetate;methyl (3S,5R)-3,5-dihydroxyhept-6-enoate |
| SMILES | C=C[C@H](O)C[C@H](O)CC(=O)OC.C=C[C@H]1C[C@@H](CC(=O)OCC)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C17H32O4Si.C8H14O4/c1-9-13-11-14(12-15(18)19-10-2)21-22(20-13,16(3,4)5)17(6,7)8;1-3-6(9)4-7(10)5-8(11)12-2/h9,13-14H,1,10-12H2,2-8H3;3,6-7,9-10H,1,4-5H2,2H3/t13-,14-;6-,7-/m00/s1 |
| InChIKey | JWWPQMCHDQHCHG-WBGMOMERSA-N |
| XLogP | 4.19 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|