C31H26ClFN2O5 — CID 159048085
4-[2-chloro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-7-methoxy-N-methylquinoline-6-carboxamide (PubChem CID 159048085) has the molecular formula C31H26ClFN2O5 and a molecular weight of 561.01 g/mol. Its IUPAC name is 4-[2-chloro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-7-methoxy-N-methylquinoline-6-carboxamide.
| Compound Name | 4-[2-chloro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-7-methoxy-N-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 159048085 |
| Molecular Formula | C31H26ClFN2O5 |
| Molecular Weight | 561.01 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 4-[2-chloro-4-[2-[1-[2-(4-fluorophenyl)acetyl]cyclopropyl]-2-oxoethyl]phenoxy]-7-methoxy-N-methylquinoline-6-carboxamide |
| SMILES | CNC(=O)c1cc2c(Oc3ccc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3Cl)ccnc2cc1OC |
| InChI | InChI=1S/C31H26ClFN2O5/c1-34-30(38)22-16-21-24(17-27(22)39-2)35-12-9-25(21)40-26-8-5-19(13-23(26)32)15-29(37)31(10-11-31)28(36)14-18-3-6-20(33)7-4-18/h3-9,12-13,16-17H,10-11,14-15H2,1-2H3,(H,34,38) |
| InChIKey | JWXHKSPLYFZNLY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.01 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|