C23H10Cl2F7N5 — CID 159048104
2,6-dichloro-4-[5-(trifluoromethyl)-2-pyridinyl]pyridine;2-fluoro-6-isocyano-4-[5-(trifluoromethyl)-2-pyridinyl]pyridine (PubChem CID 159048104) has the molecular formula C23H10Cl2F7N5 and a molecular weight of 560.26 g/mol. Its IUPAC name is 2,6-dichloro-4-[5-(trifluoromethyl)-2-pyridinyl]pyridine;2-fluoro-6-isocyano-4-[5-(trifluoromethyl)-2-pyridinyl]pyridine.
| Compound Name | 2,6-dichloro-4-[5-(trifluoromethyl)-2-pyridinyl]pyridine;2-fluoro-6-isocyano-4-[5-(trifluoromethyl)-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 159048104 |
| Molecular Formula | C23H10Cl2F7N5 |
| Molecular Weight | 560.26 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | 2,6-dichloro-4-[5-(trifluoromethyl)-2-pyridinyl]pyridine;2-fluoro-6-isocyano-4-[5-(trifluoromethyl)-2-pyridinyl]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2cc(Cl)nc(Cl)c2)nc1.[C-]#[N+]c1cc(-c2ccc(C(F)(F)F)cn2)cc(F)n1 |
| InChI | InChI=1S/C12H5F4N3.C11H5Cl2F3N2/c1-17-11-5-7(4-10(13)19-11)9-3-2-8(6-18-9)12(14,15)16;12-9-3-6(4-10(13)18-9)8-2-1-7(5-17-8)11(14,15)16/h2-6H;1-5H |
| InChIKey | JWXJEPVWAIFJGY-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.26 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|