C31H36N2O5S — CID 159048789
5-[4-(1-benzothiophen-7-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-cyclohexyl-2-pyridin-2-ylpentan-1-one;oxalic acid (PubChem CID 159048789) has the molecular formula C31H36N2O5S and a molecular weight of 548.71 g/mol. Its IUPAC name is 5-[4-(1-benzothiophen-7-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-cyclohexyl-2-pyridin-2-ylpentan-1-one;oxalic acid.
| Compound Name | 5-[4-(1-benzothiophen-7-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-cyclohexyl-2-pyridin-2-ylpentan-1-one;oxalic acid |
|---|---|
| PubChem CID | 159048789 |
| Molecular Formula | C31H36N2O5S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 5-[4-(1-benzothiophen-7-yl)-3,6-dihydro-2H-pyridin-1-yl]-1-cyclohexyl-2-pyridin-2-ylpentan-1-one;oxalic acid |
| SMILES | O=C(C1CCCCC1)C(CCCN1CC=C(c2cccc3ccsc23)CC1)c1ccccn1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H34N2OS.C2H2O4/c32-28(23-8-2-1-3-9-23)26(27-13-4-5-17-30-27)12-7-18-31-19-14-22(15-20-31)25-11-6-10-24-16-21-33-29(24)25;3-1(4)2(5)6/h4-6,10-11,13-14,16-17,21,23,26H,1-3,7-9,12,15,18-20H2;(H,3,4)(H,5,6) |
| InChIKey | VKEACPXEOFLWET-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|