About titanium;bis(trimethylsilyl 3-oxohexaneperoxoate)
titanium;bis(trimethylsilyl 3-oxohexaneperoxoate) (PubChem CID 159049384) has the molecular formula C18H36O8Si2Ti
and a molecular weight of 484.52 g/mol. Its IUPAC name is titanium;bis(trimethylsilyl 3-oxohexaneperoxoate).
Molecular Properties
| Compound Name | titanium;bis(trimethylsilyl 3-oxohexaneperoxoate) |
| PubChem CID | 159049384 |
| Molecular Formula | C18H36O8Si2Ti |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | titanium;bis(trimethylsilyl 3-oxohexaneperoxoate) |
| SMILES | CCCC(=O)CC(=O)OO[Si](C)(C)C.CCCC(=O)CC(=O)OO[Si](C)(C)C.[Ti] |
| InChI | InChI=1S/2C9H18O4Si.Ti/c2*1-5-6-8(10)7-9(11)12-13-14(2,3)4;/h2*5-7H2,1-4H3; |
| InChIKey | JXBNSQOFGOUMMD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze titanium;bis(trimethylsilyl 3-oxohexaneperoxoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of titanium;bis(trimethylsilyl 3-oxohexaneperoxoate)?
The IUPAC name of titanium;bis(trimethylsilyl 3-oxohexaneperoxoate) (CID 159049384) is titanium;bis(trimethylsilyl 3-oxohexaneperoxoate).
What is the SMILES notation for titanium;bis(trimethylsilyl 3-oxohexaneperoxoate)?
The canonical SMILES for titanium;bis(trimethylsilyl 3-oxohexaneperoxoate) is CCCC(=O)CC(=O)OO[Si](C)(C)C.CCCC(=O)CC(=O)OO[Si](C)(C)C.[Ti].
What is the InChIKey of titanium;bis(trimethylsilyl 3-oxohexaneperoxoate)?
The InChIKey is JXBNSQOFGOUMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H18O4Si.Ti/c2*1-5-6-8(10)7-9(11)12-13-14(2,3)4;/h2*5-7H2,1-4H3;.
What are the key properties of titanium;bis(trimethylsilyl 3-oxohexaneperoxoate)?
titanium;bis(trimethylsilyl 3-oxohexaneperoxoate) has a molecular weight of 484.52 g/mol, XLogP of 4.11, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for titanium;bis(trimethylsilyl 3-oxohexaneperoxoate) is sourced from PubChem (CID 159049384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).