C28H24F4N8O — CID 159049927
2-N-cyclopropyl-4,5-difluorobenzene-1,2-diamine;1-cyclopropyl-5,6-difluoro-2-pyrimidin-5-ylbenzimidazole;pyrimidine-5-carbaldehyde (PubChem CID 159049927) has the molecular formula C28H24F4N8O and a molecular weight of 564.55 g/mol. Its IUPAC name is 2-N-cyclopropyl-4,5-difluorobenzene-1,2-diamine;1-cyclopropyl-5,6-difluoro-2-pyrimidin-5-ylbenzimidazole;pyrimidine-5-carbaldehyde.
| Compound Name | 2-N-cyclopropyl-4,5-difluorobenzene-1,2-diamine;1-cyclopropyl-5,6-difluoro-2-pyrimidin-5-ylbenzimidazole;pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 159049927 |
| Molecular Formula | C28H24F4N8O |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 2-N-cyclopropyl-4,5-difluorobenzene-1,2-diamine;1-cyclopropyl-5,6-difluoro-2-pyrimidin-5-ylbenzimidazole;pyrimidine-5-carbaldehyde |
| SMILES | Fc1cc2nc(-c3cncnc3)n(C3CC3)c2cc1F.Nc1cc(F)c(F)cc1NC1CC1.O=Cc1cncnc1 |
| InChI | InChI=1S/C14H10F2N4.C9H10F2N2.C5H4N2O/c15-10-3-12-13(4-11(10)16)20(9-1-2-9)14(19-12)8-5-17-7-18-6-8;10-6-3-8(12)9(4-7(6)11)13-5-1-2-5;8-3-5-1-6-4-7-2-5/h3-7,9H,1-2H2;3-5,13H,1-2,12H2;1-4H |
| InChIKey | JXDFEQHOFXBUDI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|