C8H11F2N2NaO5S — CID 159050913
sodium [(2S,5R)-2-(1,1-difluoroethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 159050913) has the molecular formula C8H11F2N2NaO5S and a molecular weight of 308.24 g/mol. Its IUPAC name is sodium [(2S,5R)-2-(1,1-difluoroethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-(1,1-difluoroethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 159050913 |
| Molecular Formula | C8H11F2N2NaO5S |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | sodium [(2S,5R)-2-(1,1-difluoroethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | CC(F)(F)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H12F2N2O5S.Na/c1-8(9,10)6-3-2-5-4-11(6)7(13)12(5)17-18(14,15)16;/h5-6H,2-4H2,1H3,(H,14,15,16);/q;+1/p-1/t5-,6+;/m1./s1 |
| InChIKey | JXGFXTJEOCVQFQ-IBTYICNHSA-M |
| XLogP | -2.69 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|