About 3-ethylsulfanylhex-3-ene
3-ethylsulfanylhex-3-ene (PubChem CID 15905675) has the molecular formula C8H16S
and a molecular weight of 144.28 g/mol. Its IUPAC name is 3-ethylsulfanylhex-3-ene.
Molecular Properties
| Compound Name | 3-ethylsulfanylhex-3-ene |
| PubChem CID | 15905675 |
| Molecular Formula | C8H16S |
| Molecular Weight | 144.28 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 3-ethylsulfanylhex-3-ene |
| SMILES | CCC=C(CC)SCC |
| InChI | InChI=1S/C8H16S/c1-4-7-8(5-2)9-6-3/h7H,4-6H2,1-3H3 |
| InChIKey | RMJRVIGPQGTZQE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethylsulfanylhex-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfanylhex-3-ene?
The IUPAC name of 3-ethylsulfanylhex-3-ene (CID 15905675) is 3-ethylsulfanylhex-3-ene.
What is the SMILES notation for 3-ethylsulfanylhex-3-ene?
The canonical SMILES for 3-ethylsulfanylhex-3-ene is CCC=C(CC)SCC.
What is the InChIKey of 3-ethylsulfanylhex-3-ene?
The InChIKey is RMJRVIGPQGTZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16S/c1-4-7-8(5-2)9-6-3/h7H,4-6H2,1-3H3.
What are the key properties of 3-ethylsulfanylhex-3-ene?
3-ethylsulfanylhex-3-ene has a molecular weight of 144.28 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfanylhex-3-ene is sourced from PubChem (CID 15905675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).