C30H38N4O2 — CID 159056800
N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-morpholin-4-ylcyclohexyl)phenyl]-5-isocyano-3H-pyrrole-2-carboxamide (PubChem CID 159056800) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-morpholin-4-ylcyclohexyl)phenyl]-5-isocyano-3H-pyrrole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-morpholin-4-ylcyclohexyl)phenyl]-5-isocyano-3H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 159056800 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(4-morpholin-4-ylcyclohexyl)phenyl]-5-isocyano-3H-pyrrole-2-carboxamide |
| SMILES | [C-]#[N+]C1=CCC(C(=O)Nc2ccc(C3CCC(N4CCOCC4)CC3)cc2C2=CCC(C)(C)CC2)=N1 |
| InChI | InChI=1S/C30H38N4O2/c1-30(2)14-12-22(13-15-30)25-20-23(21-4-7-24(8-5-21)34-16-18-36-19-17-34)6-9-26(25)33-29(35)27-10-11-28(31-3)32-27/h6,9,11-12,20-21,24H,4-5,7-8,10,13-19H2,1-2H3,(H,33,35) |
| InChIKey | OLOMAIYRJNSPHO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|