C21H26N2O3 — CID 159057349
methyl 2,3-dimethyl-4-[3-[2-(1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybut-2-enoate (PubChem CID 159057349) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl 2,3-dimethyl-4-[3-[2-(1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybut-2-enoate.
| Compound Name | methyl 2,3-dimethyl-4-[3-[2-(1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybut-2-enoate |
|---|---|
| PubChem CID | 159057349 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | methyl 2,3-dimethyl-4-[3-[2-(1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybut-2-enoate |
| SMILES | COC(=O)C(C)=C(C)COC1CC(CCc2ccc3cccnc3n2)C1 |
| InChI | InChI=1S/C21H26N2O3/c1-14(15(2)21(24)25-3)13-26-19-11-16(12-19)6-8-18-9-7-17-5-4-10-22-20(17)23-18/h4-5,7,9-10,16,19H,6,8,11-13H2,1-3H3 |
| InChIKey | IREGWJWZMAHZRK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|