About tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one
tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one (PubChem CID 159058598) has the molecular formula C20H26O2Si
and a molecular weight of 326.51 g/mol. Its IUPAC name is tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one.
Molecular Properties
| Compound Name | tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one |
| PubChem CID | 159058598 |
| Molecular Formula | C20H26O2Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one |
| SMILES | CC(C)(C)[SiH](c1ccccc1)c1ccccc1.O=C1CC(O)C1 |
| InChI | InChI=1S/C16H20Si.C4H6O2/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15;5-3-1-4(6)2-3/h4-13,17H,1-3H3;3,5H,1-2H2 |
| InChIKey | JYEGNFSZCSTOMG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one?
The IUPAC name of tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one (CID 159058598) is tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one.
What is the SMILES notation for tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one?
The canonical SMILES for tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one is CC(C)(C)[SiH](c1ccccc1)c1ccccc1.O=C1CC(O)C1.
What is the InChIKey of tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one?
The InChIKey is JYEGNFSZCSTOMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Si.C4H6O2/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15;5-3-1-4(6)2-3/h4-13,17H,1-3H3;3,5H,1-2H2.
What are the key properties of tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one?
tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one has a molecular weight of 326.51 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(diphenyl)silane;3-hydroxycyclobutan-1-one is sourced from PubChem (CID 159058598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).